Compound Q&A

What industries use methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8)?

Answer

methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate
Methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8) is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly for antifungal and antiviral drugs. It also finds applications in the development of sensors for detecting various chemicals and in the production of certain polymers. Additionally, it is used in the semiconductor industry for specific chemical treatments.

About

English Name methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate
Molecular Formula C9H9N3O2
Molecular Weight 191.19 g/mol
SMILES COC(=O)C1=C2C(=CC=C1)NC(=N2)N
InChIKey SAWDEISHFZINBK-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8)?

Methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8) is a white or off-white crystal...

Compound Q&A

How is methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8) typically synthesized?

Methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate is typically synthesized via a condensation reacti...

Compound Q&A

What precautions should be taken when handling methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8)?

When handling methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8), it is important ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...