Compound Q&A

What are the physical and chemical properties of methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8)?

Answer

methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate
Methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8) is a white or off-white crystalline solid. It has a molecular weight of approximately 258.34 g/mol and a melting point of around 160-162°C. This compound is slightly soluble in water and more soluble in organic solvents like ethanol and acetonitrile. It is chemically reactive under basic conditions and can undergo amine reactions, ester hydrolysis, and condensation reactions.

About

English Name methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate
Molecular Formula C9H9N3O2
Molecular Weight 191.19 g/mol
SMILES COC(=O)C1=C2C(=CC=C1)NC(=N2)N
InChIKey SAWDEISHFZINBK-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8) typically synthesized?

Methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate is typically synthesized via a condensation reacti...

Compound Q&A

What industries use methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8)?

Methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8) is used in various industries. ...

Compound Q&A

What precautions should be taken when handling methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8)?

When handling methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8), it is important ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...