Compound Q&A

How is methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8) typically synthesized?

Answer

methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate
Methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate is typically synthesized via a condensation reaction between methyl 2-benzimidazolylcarboxylate and ammonia. The synthesis involves heating the reactants under reflux in an inert atmosphere. The yield can be improved by using a catalyst and maintaining an appropriate pH. The product can be purified by recrystallization from ethanol.

About

English Name methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate
Molecular Formula C9H9N3O2
Molecular Weight 191.19 g/mol
SMILES COC(=O)C1=C2C(=CC=C1)NC(=N2)N
InChIKey SAWDEISHFZINBK-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8)?

Methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8) is a white or off-white crystal...

Compound Q&A

What industries use methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8)?

Methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8) is used in various industries. ...

Compound Q&A

What precautions should be taken when handling methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8)?

When handling methyl 2-amino-1H-benzo[d]imidazole-4-carboxylate (CAS: 910122-42-8), it is important ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...