Compound Q&A

What industries use Fluquinconazole (CAS: 136426-54-5)?

Answer

Fluquinconazole
Fluquinconazole is primarily used in the agricultural sector as a fungicide to protect crops. It is also utilized in the pharmaceutical industry for its antifungal properties, particularly in the treatment of skin and nail infections. Additionally, it has applications in polymer science for enhancing the performance of plastic materials.

About

English Name Fluquinconazole
Molecular Formula C16H8Cl2FN5O
Molecular Weight 376.18 g/mol
SMILES Fc1ccc2nc(n3cncn3)n(c4ccc(Cl)cc4Cl)c(=O)c2c1
InChIKey IJJVMEJXYNJXOJ-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fluquinconazole (CAS: 136426-54-5)?

Fluquinconazole is a fungicide with a crystalline form and a molecular weight of 328.42 g/mol. It ha...

Compound Q&A

How is Fluquinconazole (CAS: 136426-54-5) typically synthesized?

Fluquinconazole is synthesized via a multi-step process involving acylation, alkylation, and condens...

Compound Q&A

What precautions should be taken when handling Fluquinconazole (CAS: 136426-54-5)?

When handling Fluquinconazole, it is essential to use proper personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...