Compound Q&A

How is Fluquinconazole (CAS: 136426-54-5) typically synthesized?

Answer

Fluquinconazole
Fluquinconazole is synthesized via a multi-step process involving acylation, alkylation, and condensation reactions. The key steps include the use of an acylating agent, a suitable catalyst like a Lewis acid, and amination to form the final product. The overall yield is around 70%, and the process is selective towards the desired product.

About

English Name Fluquinconazole
Molecular Formula C16H8Cl2FN5O
Molecular Weight 376.18 g/mol
SMILES Fc1ccc2nc(n3cncn3)n(c4ccc(Cl)cc4Cl)c(=O)c2c1
InChIKey IJJVMEJXYNJXOJ-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fluquinconazole (CAS: 136426-54-5)?

Fluquinconazole is a fungicide with a crystalline form and a molecular weight of 328.42 g/mol. It ha...

Compound Q&A

What industries use Fluquinconazole (CAS: 136426-54-5)?

Fluquinconazole is primarily used in the agricultural sector as a fungicide to protect crops. It is ...

Compound Q&A

What precautions should be taken when handling Fluquinconazole (CAS: 136426-54-5)?

When handling Fluquinconazole, it is essential to use proper personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...