Compound Q&A

What precautions should be taken when handling 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9)?

Answer

8-Bromo-5-nitroisoquinoline
Handling 8-Bromo-5-nitroisoquinoline requires caution due to its reactivity and potential to produce toxic fumes. Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn. Work should be conducted in a well-ventilated fume hood. Spills should be cleaned up using absorbent materials and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

English Name 8-Bromo-5-nitroisoquinoline
Molecular Formula C9H5BrN2O2
Molecular Weight 253.05 g/mol
SMILES C1=CC(=C2C=NC=CC2=C1[N+](=O)[O-])Br
InChIKey BCQCHGICDSWPJK-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9)?

8-Bromo-5-nitroisoquinoline is a crystalline solid with a molecular weight of approximately 256.07 g...

Compound Q&A

How is 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9) typically synthesized?

8-Bromo-5-nitroisoquinoline is typically synthesized via the nitration of 8-bromoisoquinoline follow...

Compound Q&A

What industries use 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9)?

8-Bromo-5-nitroisoquinoline finds application in pharmaceuticals, particularly in the development of...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...