Compound Q&A

What industries use 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9)?

Answer

8-Bromo-5-nitroisoquinoline
8-Bromo-5-nitroisoquinoline finds application in pharmaceuticals, particularly in the development of potential drug candidates for various diseases. It is also used in the synthesis of organic semiconductors and as a reagent in polymer chemistry for the modification of functional groups. Its use in sensors, though less common, is also explored due to its chemical reactivity.

About

English Name 8-Bromo-5-nitroisoquinoline
Molecular Formula C9H5BrN2O2
Molecular Weight 253.05 g/mol
SMILES C1=CC(=C2C=NC=CC2=C1[N+](=O)[O-])Br
InChIKey BCQCHGICDSWPJK-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9)?

8-Bromo-5-nitroisoquinoline is a crystalline solid with a molecular weight of approximately 256.07 g...

Compound Q&A

How is 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9) typically synthesized?

8-Bromo-5-nitroisoquinoline is typically synthesized via the nitration of 8-bromoisoquinoline follow...

Compound Q&A

What precautions should be taken when handling 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9)?

Handling 8-Bromo-5-nitroisoquinoline requires caution due to its reactivity and potential to produce...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...