Compound Q&A

How is 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9) typically synthesized?

Answer

8-Bromo-5-nitroisoquinoline
8-Bromo-5-nitroisoquinoline is typically synthesized via the nitration of 8-bromoisoquinoline followed by bromination of 5-nitroisoquinoline. This process often involves the use of concentrated nitric acid and sulfuric acid as the nitrating mixture, with careful control of temperature and concentration to achieve high selectivity and yield. Catalytic methods using metal complexes can also be employed for more controlled reactions.

About

English Name 8-Bromo-5-nitroisoquinoline
Molecular Formula C9H5BrN2O2
Molecular Weight 253.05 g/mol
SMILES C1=CC(=C2C=NC=CC2=C1[N+](=O)[O-])Br
InChIKey BCQCHGICDSWPJK-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9)?

8-Bromo-5-nitroisoquinoline is a crystalline solid with a molecular weight of approximately 256.07 g...

Compound Q&A

What industries use 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9)?

8-Bromo-5-nitroisoquinoline finds application in pharmaceuticals, particularly in the development of...

Compound Q&A

What precautions should be taken when handling 8-Bromo-5-nitroisoquinoline (CAS: 252861-41-9)?

Handling 8-Bromo-5-nitroisoquinoline requires caution due to its reactivity and potential to produce...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...