Compound Q&A

What precautions should be taken when handling 2-(Trifluoromethyl)quinoline (CAS: 347-42-2)?

Answer

2-(Trifluoromethyl)quinoline
When handling 2-(Trifluoromethyl)quinoline (CAS: 347-42-2), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be used in a well-ventilated area or a fume hood to minimize inhalation risk. Spills should be handled carefully, and the area should be cleaned with water and detergent. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

CAS No 347-42-2
English Name 2-(Trifluoromethyl)quinoline
Molecular Formula C10H6F3N
Molecular Weight 197.16 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=N2)C(F)(F)F
InChIKey YZSRICFIQLVSMQ-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Trifluoromethyl)quinoline (CAS: 347-42-2)?

2-(Trifluoromethyl)quinoline (CAS: 347-42-2) is a crystalline compound with a molecular weight of ap...

Compound Q&A

How is 2-(Trifluoromethyl)quinoline (CAS: 347-42-2) typically synthesized?

2-(Trifluoromethyl)quinoline (CAS: 347-42-2) is typically synthesized via the condensation of 1,4-di...

Compound Q&A

What industries use 2-(Trifluoromethyl)quinoline (CAS: 347-42-2)?

2-(Trifluoromethyl)quinoline (CAS: 347-42-2) is used in various industries, including pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...