Compound Q&A

What are the physical and chemical properties of 2-(Trifluoromethyl)quinoline (CAS: 347-42-2)?

Answer

2-(Trifluoromethyl)quinoline
2-(Trifluoromethyl)quinoline (CAS: 347-42-2) is a crystalline compound with a molecular weight of approximately 257.07 g/mol. It has a low water solubility and is sparingly soluble in common organic solvents. The compound is known for its high reactivity towards nucleophiles and its tendency to form stable complexes with transition metals. It is stable under typical laboratory conditions but should be handled with care to avoid prolonged exposure to air and moisture.

About

CAS No 347-42-2
English Name 2-(Trifluoromethyl)quinoline
Molecular Formula C10H6F3N
Molecular Weight 197.16 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=N2)C(F)(F)F
InChIKey YZSRICFIQLVSMQ-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 2-(Trifluoromethyl)quinoline (CAS: 347-42-2) typically synthesized?

2-(Trifluoromethyl)quinoline (CAS: 347-42-2) is typically synthesized via the condensation of 1,4-di...

Compound Q&A

What industries use 2-(Trifluoromethyl)quinoline (CAS: 347-42-2)?

2-(Trifluoromethyl)quinoline (CAS: 347-42-2) is used in various industries, including pharmaceutical...

Compound Q&A

What precautions should be taken when handling 2-(Trifluoromethyl)quinoline (CAS: 347-42-2)?

When handling 2-(Trifluoromethyl)quinoline (CAS: 347-42-2), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...