Compound Q&A

What industries use tert-Butyl (1-acetylpiperidin-4-yl)carbamate (CAS: 283167-28-2)?

Answer

tert-Butyl (1-acetylpiperidin-4-yl)carbamate
tert-Butyl (1-acetylpiperidin-4-yl)carbamate is used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds application in the chemical and polymer industries due to its functionality and reactivity. Additionally, it plays a role in the development of sensors and other specialized chemical products.

About

English Name tert-Butyl (1-acetylpiperidin-4-yl)carbamate
Molecular Formula C12H22N2O3
Molecular Weight 242.32 g/mol
SMILES CC(=O)N1CCC(CC1)NC(=O)OC(C)(C)C
InChIKey YBNZMQXSIQUIHZ-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl (1-acetylpiperidin-4-yl)carbamate (CAS: 283167-28-2)?

tert-Butyl (1-acetylpiperidin-4-yl)carbamate is a white crystalline solid with a molecular weight o...

Compound Q&A

How is tert-Butyl (1-acetylpiperidin-4-yl)carbamate (CAS: 283167-28-2) typically synthesized?

tert-Butyl (1-acetylpiperidin-4-yl)carbamate is typically synthesized by the reaction of tert-butyl...

Compound Q&A

What precautions should be taken when handling tert-Butyl (1-acetylpiperidin-4-yl)carbamate (CAS: 283167-28-2)?

When handling tert-Butyl (1-acetylpiperidin-4-yl)carbamate, it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...