Compound Q&A

What are the physical and chemical properties of Filanesib (CAS: 885060-09-3)?

Answer

Filanesib
Filanesib is a yellow crystalline solid with a molecular weight of approximately 739.75 g/mol. It has a solubility of about 0.012 mg/mL in water and is poorly soluble in common organic solvents. Chemically, Filanesib is stable under normal conditions but may react with strong acids or bases. It is a potent inhibitor of the p70S6 kinase, making it a critical drug candidate in oncology research.

About

English Name Filanesib
Molecular Formula C20H22F2N4O2S
Molecular Weight 420.49 g/mol
SMILES CN(C(=O)N1C(SC(=N1)C2=C(C=CC(=C2)F)F)(CCCN)C3=CC=CC=C3)OC
InChIKey LLXISKGBWFTGEI-FQEVSTJZSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is Filanesib (CAS: 885060-09-3) typically synthesized?

Filanesib is synthesized through a multi-step process involving condensation reactions, ring formati...

Compound Q&A

What industries use Filanesib (CAS: 885060-09-3)?

Filanesib is primarily used in the pharmaceutical industry for its potential in oncology. It is also...

Compound Q&A

What precautions should be taken when handling Filanesib (CAS: 885060-09-3)?

When handling Filanesib, wear appropriate personal protective equipment (PPE) such as gloves and lab...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...