Compound Q&A

What are the physical and chemical properties of (1S)-1-[4-(Trifluoromethyl)phenyl]ethanol (CAS: 99493-93-3)?

Answer

(1S)-1-[4-(Trifluoromethyl)phenyl]ethanol
(1S)-1-[4-(Trifluoromethyl)phenyl]ethanol is a colorless liquid with a molecular weight of approximately 231.13 g/mol. It has a crystalline form at room temperature and its solubility in water is low. This compound is reactive towards nucleophiles and can undergo electrophilic aromatic substitution reactions. It is slightly soluble in water and miscible with common organic solvents.

About

CAS No 99493-93-3
English Name (1S)-1-[4-(Trifluoromethyl)phenyl]ethanol
Molecular Formula C9H9F3O
Molecular Weight 190.16 g/mol
SMILES CC(C1=CC=C(C=C1)C(F)(F)F)O
InChIKey YMXIDIAEXNLCFT-LURJTMIESA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is (1S)-1-[4-(Trifluoromethyl)phenyl]ethanol (CAS: 99493-93-3) typically synthesized?

(1S)-1-[4-(Trifluoromethyl)phenyl]ethanol is typically synthesized via a Suzuki coupling reaction be...

Compound Q&A

What industries use (1S)-1-[4-(Trifluoromethyl)phenyl]ethanol (CAS: 99493-93-3)?

(1S)-1-[4-(Trifluoromethyl)phenyl]ethanol is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling (1S)-1-[4-(Trifluoromethyl)phenyl]ethanol (CAS: 99493-93-3)?

When handling (1S)-1-[4-(Trifluoromethyl)phenyl]ethanol, ensure the use of personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...