Compound Q&A

What industries use Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4)?

Answer

Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl)-
Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4) finds applications in the pharmaceutical industry for the synthesis of certain drugs, as well as in the polymer industry for improving material properties. It is also used in the production of sensors and semiconductors due to its unique chemical and physical properties.

About

English Name Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl)-
Molecular Formula C20H30ClP
Molecular Weight 336.88 g/mol
SMILES ClP(C12CC3CC(C2)CC(C1)C3)C12CC3CC(C2)CC(C1)C3
InChIKey BVOJCPQWSXCCKU-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4)?

Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4) is a crystalline soli...

Compound Q&A

How is Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4) typically synthesized?

Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4) can be synthesized by...

Compound Q&A

What precautions should be taken when handling Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4)?

When handling Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...