Compound Q&A

What are the physical and chemical properties of Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4)?

Answer

Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl)-
Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4) is a crystalline solid with a molecular weight of approximately 294.3 g/mol. It has a low solubility in water but is soluble in organic solvents. The compound is less reactive compared to simpler phosphorus compounds but can undergo nucleophilic substitution reactions. It is stable under normal conditions but should be handled with care due to its potential for decomposition upon heating or exposure to light.

About

English Name Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl)-
Molecular Formula C20H30ClP
Molecular Weight 336.88 g/mol
SMILES ClP(C12CC3CC(C2)CC(C1)C3)C12CC3CC(C2)CC(C1)C3
InChIKey BVOJCPQWSXCCKU-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4) typically synthesized?

Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4) can be synthesized by...

Compound Q&A

What industries use Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4)?

Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4) finds applications in...

Compound Q&A

What precautions should be taken when handling Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4)?

When handling Phosphinous chloride, P,P-bis(tricyclo[3.3.1.13,7]dec-1-yl) (CAS: 157282-19-4), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...