Compound Q&A

What precautions should be taken when handling (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4)?

Answer

(S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid
When handling (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. Store the compound in a cool, dry place away from direct sunlight and heat sources. Use a fume hood during handling and synthesis to minimize exposure to volatiles. In case of spill, clean up with appropriate absorbents and dispose of according to local regulations. Refer to the Safety Data Sheet (SDS) for detailed information on handling and storage.

About

English Name (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid
Molecular Formula C15H21NO4
Molecular Weight 279.34 g/mol
SMILES CC(C)(C)OC(=O)NCC(CC1=CC=CC=C1)C(=O)O
InChIKey ZYCITKXROAFBAR-LBPRGKRZSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4)?

(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid is a white crystalline solid with a molecula...

Compound Q&A

How is (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4) typically synthesized?

(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid can be synthesized by protecting the amino g...

Compound Q&A

What industries use (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4)?

(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid finds applications in the pharmaceutical ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...