Compound Q&A

What are the physical and chemical properties of (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4)?

Answer

(S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid
(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid is a white crystalline solid with a molecular weight of approximately 331.43 g/mol. It has a pKa of around 4.5, indicating moderate acidity. The compound is poorly soluble in water but soluble in organic solvents like methanol and ethanol. Chemically, it is reactive towards nucleophiles, particularly amines, and can undergo esterification and amide formation under appropriate conditions.

About

English Name (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid
Molecular Formula C15H21NO4
Molecular Weight 279.34 g/mol
SMILES CC(C)(C)OC(=O)NCC(CC1=CC=CC=C1)C(=O)O
InChIKey ZYCITKXROAFBAR-LBPRGKRZSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4) typically synthesized?

(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid can be synthesized by protecting the amino g...

Compound Q&A

What industries use (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4)?

(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid finds applications in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4)?

When handling (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid, it is essential to use approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...