Compound Q&A

What industries use (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4)?

Answer

(S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid
(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid finds applications in the pharmaceutical industry for the synthesis of peptide drugs. It is also used in the development of sensors and as a building block in polymer chemistry, particularly in the synthesis of biodegradable polymers. Its reactivity towards amines makes it valuable in organic synthesis and materials science.

About

English Name (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid
Molecular Formula C15H21NO4
Molecular Weight 279.336 g/mol
SMILES CC(C)(C)OC(=O)NCC(CC1=CC=CC=C1)C(=O)O
InChIKey ZYCITKXROAFBAR-LBPRGKRZSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4)?

(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid is a white crystalline solid with a molecula...

Compound Q&A

How is (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4) typically synthesized?

(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid can be synthesized by protecting the amino g...

Compound Q&A

What precautions should be taken when handling (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid (CAS: 189619-55-4)?

When handling (S)-2-benzyl-3-(tert-butoxycarbonylamino)propanoic acid, it is essential to use approp...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...