Compound Q&A

What precautions should be taken when handling 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5)?

Answer

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (1:1)
When handling 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate, wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Always use a fume hood during preparation and disposal. Spills should be cleaned up immediately with appropriate absorbents. Refer to the Safety Data Sheet (SDS) for detailed instructions and emergency procedures.

About

English Name 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (1:1)
Molecular Formula C13H16N2O4
Molecular Weight 264.28 g/mol
SMILES CC1=C(C2=CC=CC=C2N1)CCN.C(=O)(C(=O)O)O
InChIKey OZWLLJOHFQKSLD-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5)?

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate has a crystalline form and a molecular weight of a...

Compound Q&A

How is 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5) typically synthesized?

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate can be synthesized via a condensation reaction bet...

Compound Q&A

What industries use 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5)?

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate is primarily used in the pharmaceutical industry f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...