Compound Q&A

What are the physical and chemical properties of 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5)?

Answer

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (1:1)
2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate has a crystalline form and a molecular weight of approximately 320.31 g/mol. It has a moderate solubility in water and is less soluble in organic solvents like ethanol. The compound is stable under normal laboratory conditions but reacts with strong acids and bases. It is used in research and pharmaceutical applications.

About

English Name 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (1:1)
Molecular Formula C13H16N2O4
Molecular Weight 264.28 g/mol
SMILES CC1=C(C2=CC=CC=C2N1)CCN.C(=O)(C(=O)O)O
InChIKey OZWLLJOHFQKSLD-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5) typically synthesized?

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate can be synthesized via a condensation reaction bet...

Compound Q&A

What industries use 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5)?

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5)?

When handling 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate, wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...