Compound Q&A

How is 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5) typically synthesized?

Answer

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (1:1)
2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate can be synthesized via a condensation reaction between 2-methyl-1H-indol-3-amine and ethanedioic acid. The reaction typically uses anhydrous conditions and may require a catalyst like DMAP. The yield is generally high, and the product is isolated through recrystallization.

About

English Name 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (1:1)
Molecular Formula C13H16N2O4
Molecular Weight 264.28 g/mol
SMILES CC1=C(C2=CC=CC=C2N1)CCN.C(=O)(C(=O)O)O
InChIKey OZWLLJOHFQKSLD-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5)?

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate has a crystalline form and a molecular weight of a...

Compound Q&A

What industries use 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5)?

2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate (CAS: 859040-56-5)?

When handling 2-(2-Methyl-1H-indol-3-yl)ethanamine ethanedioate, wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...