Compound Q&A

How should Tulathromycin B (CAS: 280755-12-6) be stored?

Answer

Tulathromycin B, approximately 5%(As a mixture with Tulathromycin A)
Tulathromycin B (CAS: 280755-12-6) should be stored in a tightly closed container at room temperature (15-30°C or 59-86°F). It should be protected from light and moisture to maintain its efficacy. Refrigeration is not necessary but may be used to extend the shelf life if desired. Do not expose the compound to direct sunlight or high temperatures.

About

English Name Tulathromycin B, approximately 5%(As a mixture with Tulathromycin A)
Molecular Formula C41H79N3O12
Molecular Weight 806.09 g/mol
SMILES CCCNC[C@@]1([C@@H](O[C@H](C[C@@]1(C)OC)O[C@H]2[C@@H]([C@H]([C@](C[C@H](CN[C@@H]([C@@H](OC(=O)[C@@H]2C)[C@@](C)([C@@H](CC)O)O)C)C)(C)O)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)C)C)O
InChIKey JEBMHQVCOAWRCT-QPTWMBCESA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is Tulathromycin B (CAS: 280755-12-6)?

Tulathromycin B (CAS: 280755-12-6) is a semi-synthetic macrolide antibiotic, approximately 5% of a m...

Compound Q&A

What are the main uses of Tulathromycin B (CAS: 280755-12-6)?

Tulathromycin B (CAS: 280755-12-6) is primarily used in veterinary medicine for treating bacterial r...

Compound Q&A

Is Tulathromycin B (CAS: 280755-12-6) safe?

Tulathromycin B (CAS: 280755-12-6) is generally considered safe when used as directed. However, it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...