Compound Q&A

What are the main uses of Tulathromycin B (CAS: 280755-12-6)?

Answer

Tulathromycin B, approximately 5%(As a mixture with Tulathromycin A)
Tulathromycin B (CAS: 280755-12-6) is primarily used in veterinary medicine for treating bacterial respiratory infections, such as bronchopneumonia and rhinitis, in cattle, sheep, and swine. It is also used to control bovine respiratory disease and to prevent and treat mycoplasmal pneumonia in swine.

About

English Name Tulathromycin B, approximately 5%(As a mixture with Tulathromycin A)
Molecular Formula C41H79N3O12
Molecular Weight 806.09 g/mol
SMILES CCCNC[C@@]1([C@@H](O[C@H](C[C@@]1(C)OC)O[C@H]2[C@@H]([C@H]([C@](C[C@H](CN[C@@H]([C@@H](OC(=O)[C@@H]2C)[C@@](C)([C@@H](CC)O)O)C)C)(C)O)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)C)C)O
InChIKey JEBMHQVCOAWRCT-QPTWMBCESA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is Tulathromycin B (CAS: 280755-12-6)?

Tulathromycin B (CAS: 280755-12-6) is a semi-synthetic macrolide antibiotic, approximately 5% of a m...

Compound Q&A

Is Tulathromycin B (CAS: 280755-12-6) safe?

Tulathromycin B (CAS: 280755-12-6) is generally considered safe when used as directed. However, it i...

Compound Q&A

How should Tulathromycin B (CAS: 280755-12-6) be stored?

Tulathromycin B (CAS: 280755-12-6) should be stored in a tightly closed container at room temperatur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...