Compound Q&A

What is Tulathromycin B (CAS: 280755-12-6)?

Answer

Tulathromycin B, approximately 5%(As a mixture with Tulathromycin A)
Tulathromycin B (CAS: 280755-12-6) is a semi-synthetic macrolide antibiotic, approximately 5% of a mixture with its enantiomer Tulathromycin A. It is characterized by broad-spectrum antimicrobial activity and is used in veterinary medicine to treat respiratory and other infections.

About

English Name Tulathromycin B, approximately 5%(As a mixture with Tulathromycin A)
Molecular Formula C41H79N3O12
Molecular Weight 806.09 g/mol
SMILES CCCNC[C@@]1([C@@H](O[C@H](C[C@@]1(C)OC)O[C@H]2[C@@H]([C@H]([C@](C[C@H](CN[C@@H]([C@@H](OC(=O)[C@@H]2C)[C@@](C)([C@@H](CC)O)O)C)C)(C)O)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)C)C)O
InChIKey JEBMHQVCOAWRCT-QPTWMBCESA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What are the main uses of Tulathromycin B (CAS: 280755-12-6)?

Tulathromycin B (CAS: 280755-12-6) is primarily used in veterinary medicine for treating bacterial r...

Compound Q&A

Is Tulathromycin B (CAS: 280755-12-6) safe?

Tulathromycin B (CAS: 280755-12-6) is generally considered safe when used as directed. However, it i...

Compound Q&A

How should Tulathromycin B (CAS: 280755-12-6) be stored?

Tulathromycin B (CAS: 280755-12-6) should be stored in a tightly closed container at room temperatur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...