Compound Q&A

How should waste containing Eupalinilide B (CAS: 757202-08-7) be handled?

Answer

Eupalinilide B
Waste containing Eupalinilide B (CAS: 757202-08-7) should be collected in appropriate containers and disposed of via professional chemical waste disposal services. Environmental protection precautions, such as neutralization and stabilization, may be necessary to prevent contamination. Incineration is another method, but must be conducted under controlled conditions to minimize environmental impact.

About

English Name Eupalinilide B
Molecular Formula C20H24O6
Molecular Weight 360.4 g/mol
SMILES CC(=CCO)C(=O)OC1CC(=C)C2C=CC(C2C3C1C(=C)C(=O)O3)(C)O
InChIKey HCGYMFPNEDDKQY-UHFFFAOYSA-N
Last Updated: 2025-10-26 19:35

Related Q&A

Compound Q&A

What regulatory guidelines apply to Eupalinilide B (CAS: 757202-08-7)?

Eupalinilide B (CAS: 757202-08-7) may require registration under REACH regulations for manufacturers...

Compound Q&A

Are there alternatives to Eupalinilide B (CAS: 757202-08-7) in synthesis?

Alternative reagents such as similar natural products or synthetic analogs like Eupalinilide A may b...

Compound Q&A

What is the market or research trend for Eupalinilide B (CAS: 757202-08-7)?

Eupalinilide B (CAS: 757202-08-7) is being studied for its potential in pharmacological applications...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...