Compound Q&A

What regulatory guidelines apply to Eupalinilide B (CAS: 757202-08-7)?

Answer

Eupalinilide B
Eupalinilide B (CAS: 757202-08-7) may require registration under REACH regulations for manufacturers and importers. Additionally, it should comply with the Globally Harmonized System (GHS) for classification and labeling. FDA and EPA may also have specific requirements for its import, use, and disposal in the United States.

About

English Name Eupalinilide B
Molecular Formula C20H24O6
Molecular Weight 360.4 g/mol
SMILES CC(=CCO)C(=O)OC1CC(=C)C2C=CC(C2C3C1C(=C)C(=O)O3)(C)O
InChIKey HCGYMFPNEDDKQY-UHFFFAOYSA-N
Last Updated: 2025-10-26 19:35

Related Q&A

Compound Q&A

Are there alternatives to Eupalinilide B (CAS: 757202-08-7) in synthesis?

Alternative reagents such as similar natural products or synthetic analogs like Eupalinilide A may b...

Compound Q&A

What is the market or research trend for Eupalinilide B (CAS: 757202-08-7)?

Eupalinilide B (CAS: 757202-08-7) is being studied for its potential in pharmacological applications...

Compound Q&A

How should waste containing Eupalinilide B (CAS: 757202-08-7) be handled?

Waste containing Eupalinilide B (CAS: 757202-08-7) should be collected in appropriate containers and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...