Compound Q&A

What is the market or research trend for Eupalinilide B (CAS: 757202-08-7)?

Answer

Eupalinilide B
Eupalinilide B (CAS: 757202-08-7) is being studied for its potential in pharmacological applications, particularly as an anti-inflammatory and anticancer agent. Market trends show increasing research interest, driven by its unique chemical structure and pharmacological profile.

About

English Name Eupalinilide B
Molecular Formula C20H24O6
Molecular Weight 360.4 g/mol
SMILES CC(=CCO)C(=O)OC1CC(=C)C2C=CC(C2C3C1C(=C)C(=O)O3)(C)O
InChIKey HCGYMFPNEDDKQY-UHFFFAOYSA-N
Last Updated: 2025-10-26 19:35

Related Q&A

Compound Q&A

What regulatory guidelines apply to Eupalinilide B (CAS: 757202-08-7)?

Eupalinilide B (CAS: 757202-08-7) may require registration under REACH regulations for manufacturers...

Compound Q&A

Are there alternatives to Eupalinilide B (CAS: 757202-08-7) in synthesis?

Alternative reagents such as similar natural products or synthetic analogs like Eupalinilide A may b...

Compound Q&A

How should waste containing Eupalinilide B (CAS: 757202-08-7) be handled?

Waste containing Eupalinilide B (CAS: 757202-08-7) should be collected in appropriate containers and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...