Compound Q&A

What precautions should be taken when handling 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9)?

Answer

6-(4-Hydroxyphenoxy)hexyl acrylate
When handling 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Work should be conducted in a fume hood to minimize inhalation exposure. Spills should be immediately cleaned up using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed safety guidelines and emergency procedures.

About

English Name 6-(4-Hydroxyphenoxy)hexyl acrylate
Molecular Formula C15H20O4
Molecular Weight 264.32 g/mol
SMILES C=CC(=O)OCCCCCCOC1=CC=C(C=C1)O
InChIKey VWDSGKYABCFREO-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9)?

6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) is a colorless to light yellow liquid with a m...

Compound Q&A

How is 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) typically synthesized?

6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) can be synthesized through a combination of es...

Compound Q&A

What industries use 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9)?

6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) is primarily used in the pharmaceuticals and p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...