Compound Q&A

How is 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) typically synthesized?

Answer

6-(4-Hydroxyphenoxy)hexyl acrylate
6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) can be synthesized through a combination of esterification and acylation reactions. A common method involves the reaction of 4-hydroxyphenol with hexyl acrylate under acidic catalysis. The exact reaction conditions, such as temperature and catalyst type, can be optimized for better yield and selectivity.

About

English Name 6-(4-Hydroxyphenoxy)hexyl acrylate
Molecular Formula C15H20O4
Molecular Weight 264.32 g/mol
SMILES C=CC(=O)OCCCCCCOC1=CC=C(C=C1)O
InChIKey VWDSGKYABCFREO-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9)?

6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) is a colorless to light yellow liquid with a m...

Compound Q&A

What industries use 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9)?

6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) is primarily used in the pharmaceuticals and p...

Compound Q&A

What precautions should be taken when handling 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9)?

When handling 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9), appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...