Compound Q&A

What industries use 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9)?

Answer

6-(4-Hydroxyphenoxy)hexyl acrylate
6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) is primarily used in the pharmaceuticals and polymer industries. It serves as a monomer for the production of functional polymers and can be incorporated into drug delivery systems. Its use in sensors and semiconductors is also explored due to its chemical functionality and reactivity.

About

English Name 6-(4-Hydroxyphenoxy)hexyl acrylate
Molecular Formula C15H20O4
Molecular Weight 264.32 g/mol
SMILES C=CC(=O)OCCCCCCOC1=CC=C(C=C1)O
InChIKey VWDSGKYABCFREO-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9)?

6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) is a colorless to light yellow liquid with a m...

Compound Q&A

How is 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) typically synthesized?

6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9) can be synthesized through a combination of es...

Compound Q&A

What precautions should be taken when handling 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9)?

When handling 6-(4-Hydroxyphenoxy)hexyl acrylate (CAS: 161841-12-9), appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...