Compound Q&A

What industries use 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8)?

Answer

3-Fluoro-2-(trifluoromethyl)benzoic acid
3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8) is used in the pharmaceutical industry for the synthesis of certain drugs due to its unique chemical properties. It is also used in polymer and sensor applications, as well as in the electrochemical industry for its conductivity and reactivity.

About

English Name 3-Fluoro-2-(trifluoromethyl)benzoic acid
Molecular Formula C8H4F4O2
Molecular Weight 208.11 g/mol
SMILES OC(=O)c1cccc(F)c1C(F)(F)F
InChIKey CDGGKKODENBDJO-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8)?

3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8) is a white crystalline solid with a mole...

Compound Q&A

How is 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8) typically synthesized?

3-Fluoro-2-(trifluoromethyl)benzoic acid is typically synthesized via the Friedel-Crafts alkylation ...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8)?

When handling 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8), wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...