Compound Q&A

How is 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8) typically synthesized?

Answer

3-Fluoro-2-(trifluoromethyl)benzoic acid
3-Fluoro-2-(trifluoromethyl)benzoic acid is typically synthesized via the Friedel-Crafts alkylation of 2-(trifluoromethyl)benzoic acid with fluorobenzene in the presence of aluminum chloride as a catalyst. The reaction yields a mixture, but selective methods can be used to improve product purity.

About

English Name 3-Fluoro-2-(trifluoromethyl)benzoic acid
Molecular Formula C8H4F4O2
Molecular Weight 208.11 g/mol
SMILES OC(=O)c1cccc(F)c1C(F)(F)F
InChIKey CDGGKKODENBDJO-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8)?

3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8) is a white crystalline solid with a mole...

Compound Q&A

What industries use 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8)?

3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8) is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8)?

When handling 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8), wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...