Compound Q&A

What are the physical and chemical properties of 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8)?

Answer

3-Fluoro-2-(trifluoromethyl)benzoic acid
3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8) is a white crystalline solid with a molecular weight of 227.06 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. The compound is known for its high reactivity in nucleophilic substitution and electrophilic aromatic substitution reactions.

About

English Name 3-Fluoro-2-(trifluoromethyl)benzoic acid
Molecular Formula C8H4F4O2
Molecular Weight 208.11 g/mol
SMILES OC(=O)c1cccc(F)c1C(F)(F)F
InChIKey CDGGKKODENBDJO-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8) typically synthesized?

3-Fluoro-2-(trifluoromethyl)benzoic acid is typically synthesized via the Friedel-Crafts alkylation ...

Compound Q&A

What industries use 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8)?

3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8) is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8)?

When handling 3-Fluoro-2-(trifluoromethyl)benzoic acid (CAS: 261951-80-8), wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...