Compound Q&A

What industries use Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3)?

Answer

Dimethyl 3,5-Pyridinedicarboxylate
Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3) is used in a variety of industries, including pharmaceuticals for the synthesis of certain drugs, polymers for the production of advanced materials, and sensors for detecting specific chemical compounds. It is also utilized in the semiconductor industry for etching and other processes.

About

CAS No 4591-55-3
English Name Dimethyl 3,5-Pyridinedicarboxylate
Molecular Formula C9H9NO4
Molecular Weight 195.17 g/mol
SMILES COC(=O)C1=CC(=CN=C1)C(=O)OC
InChIKey HDTNLHHNQYBOHJ-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3)?

Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3) is a colorless to amber liquid with a molecular ...

Compound Q&A

How is Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3) typically synthesized?

Dimethyl 3,5-Pyridinedicarboxylate is typically synthesized through the reaction of pyridine-3,5-dic...

Compound Q&A

What precautions should be taken when handling Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3)?

When handling Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3), it is essential to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...