Compound Q&A

How is Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3) typically synthesized?

Answer

Dimethyl 3,5-Pyridinedicarboxylate
Dimethyl 3,5-Pyridinedicarboxylate is typically synthesized through the reaction of pyridine-3,5-dicarboxylic acid with dimethyl sulfate in the presence of a base like sodium hydroxide. The process involves the esterification of the carboxylic acid groups, resulting in high selectivity and yield. The reaction is conducted under mild conditions to ensure product purity.

About

CAS No 4591-55-3
English Name Dimethyl 3,5-Pyridinedicarboxylate
Molecular Formula C9H9NO4
Molecular Weight 195.17 g/mol
SMILES COC(=O)C1=CC(=CN=C1)C(=O)OC
InChIKey HDTNLHHNQYBOHJ-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3)?

Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3) is a colorless to amber liquid with a molecular ...

Compound Q&A

What industries use Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3)?

Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3) is used in a variety of industries, including ph...

Compound Q&A

What precautions should be taken when handling Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3)?

When handling Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3), it is essential to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...