Compound Q&A

What are the physical and chemical properties of Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3)?

Answer

Dimethyl 3,5-Pyridinedicarboxylate
Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3) is a colorless to amber liquid with a molecular weight of approximately 170.16 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. Chemically, it is highly reactive and susceptible to hydrolysis. It crystallizes in the form of prisms at low temperatures.

About

CAS No 4591-55-3
English Name Dimethyl 3,5-Pyridinedicarboxylate
Molecular Formula C9H9NO4
Molecular Weight 195.17 g/mol
SMILES COC(=O)C1=CC(=CN=C1)C(=O)OC
InChIKey HDTNLHHNQYBOHJ-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3) typically synthesized?

Dimethyl 3,5-Pyridinedicarboxylate is typically synthesized through the reaction of pyridine-3,5-dic...

Compound Q&A

What industries use Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3)?

Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3) is used in a variety of industries, including ph...

Compound Q&A

What precautions should be taken when handling Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3)?

When handling Dimethyl 3,5-Pyridinedicarboxylate (CAS: 4591-55-3), it is essential to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...