Compound Q&A

How is Methyl 3-chloro-2-hydroxybenzoate (CAS: 52159-67-8) typically synthesized?

Answer

Methyl 3-chloro-2-hydroxybenzoate
Methyl 3-chloro-2-hydroxybenzoate is typically synthesized via the esterification of 3-chloro-2-hydroxybenzoic acid with methanol in the presence of an acid catalyst such as sulfuric acid. The process involves heating the reaction mixture under reflux to achieve a high yield of the desired ester.

About

CAS No 52159-67-8
English Name Methyl 3-chloro-2-hydroxybenzoate
Molecular Formula C8H7ClO3
Molecular Weight 186.59 g/mol
SMILES COC(=O)C1=C(C(=CC=C1)Cl)O
InChIKey MVXSDDGVZSEOIS-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-chloro-2-hydroxybenzoate (CAS: 52159-67-8)?

Methyl 3-chloro-2-hydroxybenzoate has a crystalline form with a molecular weight of approximately 21...

Compound Q&A

What industries use Methyl 3-chloro-2-hydroxybenzoate (CAS: 52159-67-8)?

Methyl 3-chloro-2-hydroxybenzoate is used in various industries, including pharmaceuticals, where it...

Compound Q&A

What precautions should be taken when handling Methyl 3-chloro-2-hydroxybenzoate (CAS: 52159-67-8)?

When handling Methyl 3-chloro-2-hydroxybenzoate, it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...