Compound Q&A

What are the physical and chemical properties of Methyl 3-chloro-2-hydroxybenzoate (CAS: 52159-67-8)?

Answer

Methyl 3-chloro-2-hydroxybenzoate
Methyl 3-chloro-2-hydroxybenzoate has a crystalline form with a molecular weight of approximately 219.58 g/mol. It is slightly soluble in water and has good solubility in common organic solvents like ethanol and acetone. The compound is moderately reactive, particularly with reagents that can introduce nucleophilic substitution or oxidation reactions.

About

CAS No 52159-67-8
English Name Methyl 3-chloro-2-hydroxybenzoate
Molecular Formula C8H7ClO3
Molecular Weight 186.59 g/mol
SMILES COC(=O)C1=C(C(=CC=C1)Cl)O
InChIKey MVXSDDGVZSEOIS-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is Methyl 3-chloro-2-hydroxybenzoate (CAS: 52159-67-8) typically synthesized?

Methyl 3-chloro-2-hydroxybenzoate is typically synthesized via the esterification of 3-chloro-2-hydr...

Compound Q&A

What industries use Methyl 3-chloro-2-hydroxybenzoate (CAS: 52159-67-8)?

Methyl 3-chloro-2-hydroxybenzoate is used in various industries, including pharmaceuticals, where it...

Compound Q&A

What precautions should be taken when handling Methyl 3-chloro-2-hydroxybenzoate (CAS: 52159-67-8)?

When handling Methyl 3-chloro-2-hydroxybenzoate, it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...