Compound Q&A

What industries use Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1)?

Answer

Methyl 3-bromo-2-methyl-5-nitrobenzoate
Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It also has applications in the polymer industry for the development of certain types of resins and plastics. Additionally, it can be utilized in the production of sensors and semiconductors due to its unique chemical properties.

About

English Name Methyl 3-bromo-2-methyl-5-nitrobenzoate
Molecular Formula C9H8BrNO4
Molecular Weight 274.07 g/mol
SMILES CC1=C(C=C(C=C1Br)[N+](=O)[O-])C(=O)OC
InChIKey KHYSOGYKNCNXIS-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1)?

Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) is a crystalline solid with a molecular w...

Compound Q&A

How is Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) typically synthesized?

Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) can be synthesized via the nitration of 3...

Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1)?

When handling Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...