Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1)?

Answer

Methyl 3-bromo-2-methyl-5-nitrobenzoate
Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) is a crystalline solid with a molecular weight of approximately 287.03 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. Chemically, it is known for its reactivity, particularly towards nucleophilic substitution reactions at the bromine atom. It is stable under normal storage conditions but requires care in reactive conditions.

About

English Name Methyl 3-bromo-2-methyl-5-nitrobenzoate
Molecular Formula C9H8BrNO4
Molecular Weight 274.07 g/mol
SMILES CC1=C(C=C(C=C1Br)[N+](=O)[O-])C(=O)OC
InChIKey KHYSOGYKNCNXIS-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) typically synthesized?

Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) can be synthesized via the nitration of 3...

Compound Q&A

What industries use Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1)?

Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1)?

When handling Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...