Compound Q&A

How is Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) typically synthesized?

Answer

Methyl 3-bromo-2-methyl-5-nitrobenzoate
Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) can be synthesized via the nitration of 3-methyl-2-methylbenzoic acid followed by bromination. This process typically involves the use of concentrated nitric acid and sulfuric acid for nitration, and thionyl bromide for bromination. The reaction conditions and catalysts are carefully controlled to achieve high selectivity and yield.

About

English Name Methyl 3-bromo-2-methyl-5-nitrobenzoate
Molecular Formula C9H8BrNO4
Molecular Weight 274.07 g/mol
SMILES CC1=C(C=C(C=C1Br)[N+](=O)[O-])C(=O)OC
InChIKey KHYSOGYKNCNXIS-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1)?

Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) is a crystalline solid with a molecular w...

Compound Q&A

What industries use Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1)?

Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1)?

When handling Methyl 3-bromo-2-methyl-5-nitrobenzoate (CAS: 885519-05-1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...