Compound Q&A

What industries use 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2)?

Answer

1-Octyl-3-methylimidazolium hydrogen sulfate
1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2) is utilized in various industries. It is widely used in the pharmaceuticals industry for the synthesis of organic compounds and as a solubilizing agent. In the polymer industry, it serves as an electrolyte in ionic liquids used for polymer synthesis. Additionally, it is applied in sensors and semiconductors for its conductivity and stability properties.

About

English Name 1-Octyl-3-methylimidazolium hydrogen sulfate
Molecular Formula C24H46N4O4S
Molecular Weight 486.71 g/mol
SMILES CCCCCCCCN1C=C[N+](=C1)C.OS(=O)(=O)[O-]
InChIKey GPIJBSJJVCIQJA-UHFFFAOYSA-L
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2)?

1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2) is a solid at room temperature with ...

Compound Q&A

How is 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2) typically synthesized?

1-Octyl-3-methylimidazolium hydrogen sulfate is typically synthesized by the reaction of 1-octylimid...

Compound Q&A

What precautions should be taken when handling 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2)?

When handling 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...