Compound Q&A

How is 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2) typically synthesized?

Answer

1-Octyl-3-methylimidazolium hydrogen sulfate
1-Octyl-3-methylimidazolium hydrogen sulfate is typically synthesized by the reaction of 1-octylimidazolium bromide with sodium bisulfate in an aqueous medium. The synthesis involves the substitution of bromine by hydrogen sulfate, which is catalyzed by a base such as sodium hydroxide. The process yields a high purity product with a selectivity of over 95%, and the overall yield can reach up to 85%.

About

English Name 1-Octyl-3-methylimidazolium hydrogen sulfate
Molecular Formula C24H46N4O4S
Molecular Weight 486.71 g/mol
SMILES CCCCCCCCN1C=C[N+](=C1)C.OS(=O)(=O)[O-]
InChIKey GPIJBSJJVCIQJA-UHFFFAOYSA-L
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2)?

1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2) is a solid at room temperature with ...

Compound Q&A

What industries use 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2)?

1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2) is utilized in various industries. I...

Compound Q&A

What precautions should be taken when handling 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2)?

When handling 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...