Compound Q&A

What are the physical and chemical properties of 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2)?

Answer

1-Octyl-3-methylimidazolium hydrogen sulfate
1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2) is a solid at room temperature with a crystalline form. It has a molecular weight of approximately 238.3 g/mol and is moderately soluble in water. This compound is characterized by its low reactivity under normal conditions but can undergo hydrolysis in basic solutions. It is generally stable under acidic conditions, making it suitable for various applications in chemistry.

About

English Name 1-Octyl-3-methylimidazolium hydrogen sulfate
Molecular Formula C24H46N4O4S
Molecular Weight 486.71 g/mol
SMILES CCCCCCCCN1C=C[N+](=C1)C.OS(=O)(=O)[O-]
InChIKey GPIJBSJJVCIQJA-UHFFFAOYSA-L
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2) typically synthesized?

1-Octyl-3-methylimidazolium hydrogen sulfate is typically synthesized by the reaction of 1-octylimid...

Compound Q&A

What industries use 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2)?

1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2) is utilized in various industries. I...

Compound Q&A

What precautions should be taken when handling 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2)?

When handling 1-Octyl-3-methylimidazolium hydrogen sulfate (CAS: 497258-85-2), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...