Compound Q&A

What precautions should be taken when handling Tert-butyl 4-iodobenzoate (CAS: 120363-13-5)?

Answer

Tert-butyl 4-iodobenzoate
When handling Tert-butyl 4-iodobenzoate (CAS: 120363-13-5), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be carried out in a fume hood to minimize inhalation risks. Spills should be cleaned up carefully following standard laboratory protocols. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name Tert-butyl 4-iodobenzoate
Molecular Formula C11H13IO2
Molecular Weight 304.13 g/mol
SMILES CC(C)(C)OC(=O)C1=CC=C(C=C1)I
InChIKey QHHNHUWOOFETNQ-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 4-iodobenzoate (CAS: 120363-13-5)?

Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) is a solid with a crystalline form. The molecular weigh...

Compound Q&A

How is Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) typically synthesized?

Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) is typically synthesized through the reaction of 4-iodo...

Compound Q&A

What industries use Tert-butyl 4-iodobenzoate (CAS: 120363-13-5)?

Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) finds applications in various industries, particularly ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...