Compound Q&A

What are the physical and chemical properties of Tert-butyl 4-iodobenzoate (CAS: 120363-13-5)?

Answer

Tert-butyl 4-iodobenzoate
Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) is a solid with a crystalline form. The molecular weight is approximately 320.02 g/mol. It has low water solubility but is soluble in organic solvents like dichloromethane and acetonitrile. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions, making it useful in organic synthesis.

About

English Name Tert-butyl 4-iodobenzoate
Molecular Formula C11H13IO2
Molecular Weight 304.13 g/mol
SMILES CC(C)(C)OC(=O)C1=CC=C(C=C1)I
InChIKey QHHNHUWOOFETNQ-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) typically synthesized?

Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) is typically synthesized through the reaction of 4-iodo...

Compound Q&A

What industries use Tert-butyl 4-iodobenzoate (CAS: 120363-13-5)?

Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) finds applications in various industries, particularly ...

Compound Q&A

What precautions should be taken when handling Tert-butyl 4-iodobenzoate (CAS: 120363-13-5)?

When handling Tert-butyl 4-iodobenzoate (CAS: 120363-13-5), it is essential to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...