Compound Q&A

How is Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) typically synthesized?

Answer

Tert-butyl 4-iodobenzoate
Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) is typically synthesized through the reaction of 4-iodobenzoic acid with tert-butyl alcohol in the presence of a catalyst such as sulfuric acid or p-toluenesulfonic acid, followed by removal of the acid to yield the ester product with high yield and good selectivity.

About

English Name Tert-butyl 4-iodobenzoate
Molecular Formula C11H13IO2
Molecular Weight 304.13 g/mol
SMILES CC(C)(C)OC(=O)C1=CC=C(C=C1)I
InChIKey QHHNHUWOOFETNQ-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 4-iodobenzoate (CAS: 120363-13-5)?

Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) is a solid with a crystalline form. The molecular weigh...

Compound Q&A

What industries use Tert-butyl 4-iodobenzoate (CAS: 120363-13-5)?

Tert-butyl 4-iodobenzoate (CAS: 120363-13-5) finds applications in various industries, particularly ...

Compound Q&A

What precautions should be taken when handling Tert-butyl 4-iodobenzoate (CAS: 120363-13-5)?

When handling Tert-butyl 4-iodobenzoate (CAS: 120363-13-5), it is essential to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...