Compound Q&A

What industries use (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8)?

Answer

(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone
(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It also finds applications in the development of sensors and semiconductors, where its functional groups contribute to the desired properties of the final products.

About

CAS No 735-06-8
English Name (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone
Molecular Formula C14H11FN2O3
Molecular Weight 274.25 g/mol
SMILES CNC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)C2=CC=CC=C2F
InChIKey GVXPKRIRHDRCGY-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8)?

(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) is a crystalline solid with...

Compound Q&A

How is (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) typically synthesized?

(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) can be synthesized through ...

Compound Q&A

What precautions should be taken when handling (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8)?

When handling (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...