Compound Q&A

How is (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) typically synthesized?

Answer

(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone
(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) can be synthesized through a multistep process involving the nitration of a 2-fluorophenyl group, followed by the coupling of the resulting nitro compound with a methylamine derivative. The reaction is typically conducted with appropriate solvents and under controlled temperature conditions, yielding the compound with a good selectivity and high yield.

About

CAS No 735-06-8
English Name (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone
Molecular Formula C14H11FN2O3
Molecular Weight 274.25 g/mol
SMILES CNC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)C2=CC=CC=C2F
InChIKey GVXPKRIRHDRCGY-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8)?

(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) is a crystalline solid with...

Compound Q&A

What industries use (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8)?

(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8)?

When handling (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...