Compound Q&A

What are the physical and chemical properties of (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8)?

Answer

(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone
(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) is a crystalline solid with a molecular weight of approximately 321.12 g/mol. It has a solubility of about 2 g/L in water and is relatively stable in air and light. It exhibits good reactivity towards nucleophiles and can undergo substitution, reduction, and other reactions due to its functional groups.

About

CAS No 735-06-8
English Name (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone
Molecular Formula C14H11FN2O3
Molecular Weight 274.25 g/mol
SMILES CNC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)C2=CC=CC=C2F
InChIKey GVXPKRIRHDRCGY-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) typically synthesized?

(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) can be synthesized through ...

Compound Q&A

What industries use (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8)?

(2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8)?

When handling (2-Fluorophenyl)[2-(methylamino)-5-nitrophenyl]methanone (CAS: 735-06-8), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...